C14H20N2O2 — CID 160806727
aziridine;(2R,3S)-3-(2,4,6-trimethylphenyl)aziridine-2-carboxylic acid (PubChem CID 160806727) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is aziridine;(2R,3S)-3-(2,4,6-trimethylphenyl)aziridine-2-carboxylic acid.
| Compound Name | aziridine;(2R,3S)-3-(2,4,6-trimethylphenyl)aziridine-2-carboxylic acid |
|---|---|
| PubChem CID | 160806727 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | aziridine;(2R,3S)-3-(2,4,6-trimethylphenyl)aziridine-2-carboxylic acid |
| SMILES | C1CN1.Cc1cc(C)c([C@@H]2N[C@H]2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C12H15NO2.C2H5N/c1-6-4-7(2)9(8(3)5-6)10-11(13-10)12(14)15;1-2-3-1/h4-5,10-11,13H,1-3H3,(H,14,15);3H,1-2H2/t10-,11+;/m0./s1 |
| InChIKey | SDUDFRROWXMALH-VZXYPILPSA-N |
| XLogP | 1.30 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|