4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid

C15H21NO2 — CID 82086541

IUPAC4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid
SMILESCc1cc(C)c(C2(C(=O)O)CCNCC2)c(C)c1
InChIInChI=1S/C15H21NO2/c1-10-8-11(2)13(12(3)9-10)15(14(17)18)4-6-16-7-5-15/h8-9,16H,4-7H2,1-3H3,(H,17,18)
InChIKeyUBKJAKMLGWFITM-UHFFFAOYSA-N
MW247.34 g/mol
LogP2.32
Rot. Bonds2

About 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid

4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid (PubChem CID 82086541) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid.

Molecular Properties

Compound Name4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid
PubChem CID82086541
Molecular FormulaC15H21NO2
Molecular Weight247.34 g/mol
Exact Mass247.16
IUPAC Name4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid
SMILESCc1cc(C)c(C2(C(=O)O)CCNCC2)c(C)c1
InChIInChI=1S/C15H21NO2/c1-10-8-11(2)13(12(3)9-10)15(14(17)18)4-6-16-7-5-15/h8-9,16H,4-7H2,1-3H3,(H,17,18)
InChIKeyUBKJAKMLGWFITM-UHFFFAOYSA-N
XLogP2.32
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.34
LogP ≤ 52.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid?
The IUPAC name of 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid (CID 82086541) is 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid.
What is the SMILES notation for 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid?
The canonical SMILES for 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid is Cc1cc(C)c(C2(C(=O)O)CCNCC2)c(C)c1.
What is the InChIKey of 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid?
The InChIKey is UBKJAKMLGWFITM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-10-8-11(2)13(12(3)9-10)15(14(17)18)4-6-16-7-5-15/h8-9,16H,4-7H2,1-3H3,(H,17,18).
What are the key properties of 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid?
4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid has a molecular weight of 247.34 g/mol, XLogP of 2.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4,6-trimethylphenyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 82086541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).