C13H16O4 — CID 116871795
3-(2-methoxy-4,6-dimethylphenyl)oxetane-3-carboxylic acid (PubChem CID 116871795) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-(2-methoxy-4,6-dimethylphenyl)oxetane-3-carboxylic acid.
| Compound Name | 3-(2-methoxy-4,6-dimethylphenyl)oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 116871795 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(2-methoxy-4,6-dimethylphenyl)oxetane-3-carboxylic acid |
| SMILES | COc1cc(C)cc(C)c1C1(C(=O)O)COC1 |
| InChI | InChI=1S/C13H16O4/c1-8-4-9(2)11(10(5-8)16-3)13(12(14)15)6-17-7-13/h4-5H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | BPPPCOUTAYRKNN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |