C13H17NO5 — CID 116876194
3-(2,4,6-trimethoxyphenyl)oxetane-3-carboxamide (PubChem CID 116876194) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-(2,4,6-trimethoxyphenyl)oxetane-3-carboxamide.
| Compound Name | 3-(2,4,6-trimethoxyphenyl)oxetane-3-carboxamide |
|---|---|
| PubChem CID | 116876194 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-(2,4,6-trimethoxyphenyl)oxetane-3-carboxamide |
| SMILES | COc1cc(OC)c(C2(C(N)=O)COC2)c(OC)c1 |
| InChI | InChI=1S/C13H17NO5/c1-16-8-4-9(17-2)11(10(5-8)18-3)13(12(14)15)6-19-7-13/h4-5H,6-7H2,1-3H3,(H2,14,15) |
| InChIKey | UNEGPCGYTHZFIB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |