C17H23NO2 — CID 82488852
(E)-3-piperidin-4-yl-3-(2,4,6-trimethylphenyl)prop-2-enoic acid (PubChem CID 82488852) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (E)-3-piperidin-4-yl-3-(2,4,6-trimethylphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-piperidin-4-yl-3-(2,4,6-trimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82488852 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (E)-3-piperidin-4-yl-3-(2,4,6-trimethylphenyl)prop-2-enoic acid |
| SMILES | Cc1cc(C)c(/C(=C/C(=O)O)C2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C17H23NO2/c1-11-8-12(2)17(13(3)9-11)15(10-16(19)20)14-4-6-18-7-5-14/h8-10,14,18H,4-7H2,1-3H3,(H,19,20)/b15-10+ |
| InChIKey | QOBRQTVDVPRUET-XNTDXEJSSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|