C16H20O3 — CID 82301735
(E)-3-cyclobutyl-3-(2-methoxy-3,5-dimethylphenyl)prop-2-enoic acid (PubChem CID 82301735) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (E)-3-cyclobutyl-3-(2-methoxy-3,5-dimethylphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-cyclobutyl-3-(2-methoxy-3,5-dimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82301735 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (E)-3-cyclobutyl-3-(2-methoxy-3,5-dimethylphenyl)prop-2-enoic acid |
| SMILES | COc1c(C)cc(C)cc1/C(=C/C(=O)O)C1CCC1 |
| InChI | InChI=1S/C16H20O3/c1-10-7-11(2)16(19-3)14(8-10)13(9-15(17)18)12-5-4-6-12/h7-9,12H,4-6H2,1-3H3,(H,17,18)/b13-9+ |
| InChIKey | YVKDOXQDXIZZBL-UKTHLTGXSA-N |
| XLogP | 3.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|