(E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid

C16H21NO2 — CID 82484136

IUPAC(E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid
SMILESCc1ccc(/C(=C/C(=O)O)C2CCNCC2)cc1C
InChIInChI=1S/C16H21NO2/c1-11-3-4-14(9-12(11)2)15(10-16(18)19)13-5-7-17-8-6-13/h3-4,9-10,13,17H,5-8H2,1-2H3,(H,18,19)/b15-10+
InChIKeyIYTDXQPGWKPVOA-XNTDXEJSSA-N
MW259.35 g/mol
LogP2.77
Rot. Bonds3

About (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid

(E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid (PubChem CID 82484136) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid
PubChem CID82484136
Molecular FormulaC16H21NO2
Molecular Weight259.35 g/mol
Exact Mass259.16
IUPAC Name(E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid
SMILESCc1ccc(/C(=C/C(=O)O)C2CCNCC2)cc1C
InChIInChI=1S/C16H21NO2/c1-11-3-4-14(9-12(11)2)15(10-16(18)19)13-5-7-17-8-6-13/h3-4,9-10,13,17H,5-8H2,1-2H3,(H,18,19)/b15-10+
InChIKeyIYTDXQPGWKPVOA-XNTDXEJSSA-N
XLogP2.77
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.35
LogP ≤ 52.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid?
The IUPAC name of (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid (CID 82484136) is (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid.
What is the SMILES notation for (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid?
The canonical SMILES for (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid is Cc1ccc(/C(=C/C(=O)O)C2CCNCC2)cc1C.
What is the InChIKey of (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid?
The InChIKey is IYTDXQPGWKPVOA-XNTDXEJSSA-N. The full InChI is InChI=1S/C16H21NO2/c1-11-3-4-14(9-12(11)2)15(10-16(18)19)13-5-7-17-8-6-13/h3-4,9-10,13,17H,5-8H2,1-2H3,(H,18,19)/b15-10+.
What are the key properties of (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid?
(E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid has a molecular weight of 259.35 g/mol, XLogP of 2.77, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,4-dimethylphenyl)-3-piperidin-4-ylprop-2-enoic acid is sourced from PubChem (CID 82484136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).