C12H18ClN — CID 171197280
(2R)-2-(2,4,6-trimethylphenyl)azetidine;hydrochloride (PubChem CID 171197280) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is (2R)-2-(2,4,6-trimethylphenyl)azetidine;hydrochloride.
| Compound Name | (2R)-2-(2,4,6-trimethylphenyl)azetidine;hydrochloride |
|---|---|
| PubChem CID | 171197280 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (2R)-2-(2,4,6-trimethylphenyl)azetidine;hydrochloride |
| SMILES | Cc1cc(C)c([C@H]2CCN2)c(C)c1.Cl |
| InChI | InChI=1S/C12H17N.ClH/c1-8-6-9(2)12(10(3)7-8)11-4-5-13-11;/h6-7,11,13H,4-5H2,1-3H3;1H/t11-;/m1./s1 |
| InChIKey | LHGSOEDATGWPHR-RFVHGSKJSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |