C14H22N2 — CID 116829218
2-methyl-3-(2,4,6-trimethylphenyl)piperazine (PubChem CID 116829218) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-methyl-3-(2,4,6-trimethylphenyl)piperazine.
| Compound Name | 2-methyl-3-(2,4,6-trimethylphenyl)piperazine |
|---|---|
| PubChem CID | 116829218 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-methyl-3-(2,4,6-trimethylphenyl)piperazine |
| SMILES | Cc1cc(C)c(C2NCCNC2C)c(C)c1 |
| InChI | InChI=1S/C14H22N2/c1-9-7-10(2)13(11(3)8-9)14-12(4)15-5-6-16-14/h7-8,12,14-16H,5-6H2,1-4H3 |
| InChIKey | AFLLPTODDYROLA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |