C21H16F6O — CID 73011573
bis(2-cyclobutyl-3,4,5-trifluorophenyl)methanone (PubChem CID 73011573) has the molecular formula C21H16F6O and a molecular weight of 398.35 g/mol. Its IUPAC name is bis(2-cyclobutyl-3,4,5-trifluorophenyl)methanone.
| Compound Name | bis(2-cyclobutyl-3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 73011573 |
| Molecular Formula | C21H16F6O |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | bis(2-cyclobutyl-3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1C1CCC1)c1cc(F)c(F)c(F)c1C1CCC1 |
| InChI | InChI=1S/C21H16F6O/c22-13-7-11(15(9-3-1-4-9)19(26)17(13)24)21(28)12-8-14(23)18(25)20(27)16(12)10-5-2-6-10/h7-10H,1-6H2 |
| InChIKey | PFMDBNLHKLXJGV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|