C25H30O — CID 73011576
bis(2-cyclobutyl-3,4-dimethylphenyl)methanone (PubChem CID 73011576) has the molecular formula C25H30O and a molecular weight of 346.51 g/mol. Its IUPAC name is bis(2-cyclobutyl-3,4-dimethylphenyl)methanone.
| Compound Name | bis(2-cyclobutyl-3,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 73011576 |
| Molecular Formula | C25H30O |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | bis(2-cyclobutyl-3,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(C)c(C)c2C2CCC2)c(C2CCC2)c1C |
| InChI | InChI=1S/C25H30O/c1-15-11-13-21(23(17(15)3)19-7-5-8-19)25(26)22-14-12-16(2)18(4)24(22)20-9-6-10-20/h11-14,19-20H,5-10H2,1-4H3 |
| InChIKey | RUDHGIPIRVFVFH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |