C21H18F4O — CID 73011575
bis(2-cyclobutyl-3,4-difluorophenyl)methanone (PubChem CID 73011575) has the molecular formula C21H18F4O and a molecular weight of 362.37 g/mol. Its IUPAC name is bis(2-cyclobutyl-3,4-difluorophenyl)methanone.
| Compound Name | bis(2-cyclobutyl-3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 73011575 |
| Molecular Formula | C21H18F4O |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | bis(2-cyclobutyl-3,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1C1CCC1)c1ccc(F)c(F)c1C1CCC1 |
| InChI | InChI=1S/C21H18F4O/c22-15-9-7-13(17(19(15)24)11-3-1-4-11)21(26)14-8-10-16(23)20(25)18(14)12-5-2-6-12/h7-12H,1-6H2 |
| InChIKey | FIMYQVRYGHQNGV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |