C11H10F2O2 — CID 177059742
(2-cyclobutyl-3,4-difluorophenyl) formate (PubChem CID 177059742) has the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. Its IUPAC name is (2-cyclobutyl-3,4-difluorophenyl) formate.
| Compound Name | (2-cyclobutyl-3,4-difluorophenyl) formate |
|---|---|
| PubChem CID | 177059742 |
| Molecular Formula | C11H10F2O2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (2-cyclobutyl-3,4-difluorophenyl) formate |
| SMILES | O=COc1ccc(F)c(F)c1C1CCC1 |
| InChI | InChI=1S/C11H10F2O2/c12-8-4-5-9(15-6-14)10(11(8)13)7-2-1-3-7/h4-7H,1-3H2 |
| InChIKey | ACLPWBADLBUOLD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|