C14H16F2O — CID 153282573
1-cyclopentyl-4-cyclopropyloxy-2,3-difluorobenzene (PubChem CID 153282573) has the molecular formula C14H16F2O and a molecular weight of 238.28 g/mol. Its IUPAC name is 1-cyclopentyl-4-cyclopropyloxy-2,3-difluorobenzene.
| Compound Name | 1-cyclopentyl-4-cyclopropyloxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 153282573 |
| Molecular Formula | C14H16F2O |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 1-cyclopentyl-4-cyclopropyloxy-2,3-difluorobenzene |
| SMILES | Fc1c(OC2CC2)ccc(C2CCCC2)c1F |
| InChI | InChI=1S/C14H16F2O/c15-13-11(9-3-1-2-4-9)7-8-12(14(13)16)17-10-5-6-10/h7-10H,1-6H2 |
| InChIKey | LSHUJBWMVXSNMH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |