C12H14F2O — CID 134218235
4-cyclohexyl-2,3-difluorophenol (PubChem CID 134218235) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-cyclohexyl-2,3-difluorophenol.
| Compound Name | 4-cyclohexyl-2,3-difluorophenol |
|---|---|
| PubChem CID | 134218235 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-cyclohexyl-2,3-difluorophenol |
| SMILES | Oc1ccc(C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C12H14F2O/c13-11-9(6-7-10(15)12(11)14)8-4-2-1-3-5-8/h6-8,15H,1-5H2 |
| InChIKey | PACJDWIZZDIQKO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |