C12H12F2O — CID 142647860
3-cyclopent-3-en-1-yl-1,2-difluoro-4-methoxybenzene (PubChem CID 142647860) has the molecular formula C12H12F2O and a molecular weight of 210.22 g/mol. Its IUPAC name is 3-cyclopent-3-en-1-yl-1,2-difluoro-4-methoxybenzene.
| Compound Name | 3-cyclopent-3-en-1-yl-1,2-difluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 142647860 |
| Molecular Formula | C12H12F2O |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-cyclopent-3-en-1-yl-1,2-difluoro-4-methoxybenzene |
| SMILES | COc1ccc(F)c(F)c1C1CC=CC1 |
| InChI | InChI=1S/C12H12F2O/c1-15-10-7-6-9(13)12(14)11(10)8-4-2-3-5-8/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | WIXZCCHUJOWWFY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|