C15H6Br2F6O — CID 139698700
bis[2-(bromomethyl)-3,4,5-trifluorophenyl]methanone (PubChem CID 139698700) has the molecular formula C15H6Br2F6O and a molecular weight of 476.01 g/mol. Its IUPAC name is bis[2-(bromomethyl)-3,4,5-trifluorophenyl]methanone.
| Compound Name | bis[2-(bromomethyl)-3,4,5-trifluorophenyl]methanone |
|---|---|
| PubChem CID | 139698700 |
| Molecular Formula | C15H6Br2F6O |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 473.87 |
| IUPAC Name | bis[2-(bromomethyl)-3,4,5-trifluorophenyl]methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1CBr)c1cc(F)c(F)c(F)c1CBr |
| InChI | InChI=1S/C15H6Br2F6O/c16-3-7-5(1-9(18)13(22)11(7)20)15(24)6-2-10(19)14(23)12(21)8(6)4-17/h1-2H,3-4H2 |
| InChIKey | NLEBVEOTBSOYNJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|