C11H12F2 — CID 171097226
2-cyclopropyl-5-ethyl-1,3-difluorobenzene (PubChem CID 171097226) has the molecular formula C11H12F2 and a molecular weight of 182.21 g/mol. Its IUPAC name is 2-cyclopropyl-5-ethyl-1,3-difluorobenzene.
| Compound Name | 2-cyclopropyl-5-ethyl-1,3-difluorobenzene |
|---|---|
| PubChem CID | 171097226 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-cyclopropyl-5-ethyl-1,3-difluorobenzene |
| SMILES | CCc1cc(F)c(C2CC2)c(F)c1 |
| InChI | InChI=1S/C11H12F2/c1-2-7-5-9(12)11(8-3-4-8)10(13)6-7/h5-6,8H,2-4H2,1H3 |
| InChIKey | FZKMISUPNGADIL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |