C10H12F2N2 — CID 139566322
1-(4-ethyl-2,6-difluorophenyl)-1,3-diazetidine (PubChem CID 139566322) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(4-ethyl-2,6-difluorophenyl)-1,3-diazetidine.
| Compound Name | 1-(4-ethyl-2,6-difluorophenyl)-1,3-diazetidine |
|---|---|
| PubChem CID | 139566322 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(4-ethyl-2,6-difluorophenyl)-1,3-diazetidine |
| SMILES | CCc1cc(F)c(N2CNC2)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2/c1-2-7-3-8(11)10(9(12)4-7)14-5-13-6-14/h3-4,13H,2,5-6H2,1H3 |
| InChIKey | SHRBVEYARZXVRF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |