C17H17F — CID 167219024
2-(4-cyclopropylphenyl)-4-ethyl-1-fluorobenzene (PubChem CID 167219024) has the molecular formula C17H17F and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(4-cyclopropylphenyl)-4-ethyl-1-fluorobenzene.
| Compound Name | 2-(4-cyclopropylphenyl)-4-ethyl-1-fluorobenzene |
|---|---|
| PubChem CID | 167219024 |
| Molecular Formula | C17H17F |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-(4-cyclopropylphenyl)-4-ethyl-1-fluorobenzene |
| SMILES | CCc1ccc(F)c(-c2ccc(C3CC3)cc2)c1 |
| InChI | InChI=1S/C17H17F/c1-2-12-3-10-17(18)16(11-12)15-8-6-14(7-9-15)13-4-5-13/h3,6-11,13H,2,4-5H2,1H3 |
| InChIKey | KTMKRAWYEVCGSP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |