C20H23F — CID 139911152
1-(4-ethylcyclohexyl)-4-(2-fluorophenyl)benzene (PubChem CID 139911152) has the molecular formula C20H23F and a molecular weight of 282.40 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-4-(2-fluorophenyl)benzene.
| Compound Name | 1-(4-ethylcyclohexyl)-4-(2-fluorophenyl)benzene |
|---|---|
| PubChem CID | 139911152 |
| Molecular Formula | C20H23F |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-4-(2-fluorophenyl)benzene |
| SMILES | CCC1CCC(c2ccc(-c3ccccc3F)cc2)CC1 |
| InChI | InChI=1S/C20H23F/c1-2-15-7-9-16(10-8-15)17-11-13-18(14-12-17)19-5-3-4-6-20(19)21/h3-6,11-16H,2,7-10H2,1H3 |
| InChIKey | NGBZUAXNXITTNL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |