C25H23F5 — CID 139846563
6-[4-(2,6-difluoro-4-propylphenyl)cyclohexyl]-1,2,3-trifluoronaphthalene (PubChem CID 139846563) has the molecular formula C25H23F5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 6-[4-(2,6-difluoro-4-propylphenyl)cyclohexyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[4-(2,6-difluoro-4-propylphenyl)cyclohexyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139846563 |
| Molecular Formula | C25H23F5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 6-[4-(2,6-difluoro-4-propylphenyl)cyclohexyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCCc1cc(F)c(C2CCC(c3ccc4c(F)c(F)c(F)cc4c3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H23F5/c1-2-3-14-10-20(26)23(21(27)11-14)16-6-4-15(5-7-16)17-8-9-19-18(12-17)13-22(28)25(30)24(19)29/h8-13,15-16H,2-7H2,1H3 |
| InChIKey | MSKBTNGEQXFOFZ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|