C24H18F6 — CID 139852466
2-(4-ethyl-2,6-difluorophenyl)-5,7,8-trifluoro-6-(4-fluorophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852466) has the molecular formula C24H18F6 and a molecular weight of 420.40 g/mol. Its IUPAC name is 2-(4-ethyl-2,6-difluorophenyl)-5,7,8-trifluoro-6-(4-fluorophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(4-ethyl-2,6-difluorophenyl)-5,7,8-trifluoro-6-(4-fluorophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852466 |
| Molecular Formula | C24H18F6 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(4-ethyl-2,6-difluorophenyl)-5,7,8-trifluoro-6-(4-fluorophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCc1cc(F)c(C2CCc3c(F)c(-c4ccc(F)cc4)c(F)c(F)c3C2)c(F)c1 |
| InChI | InChI=1S/C24H18F6/c1-2-12-9-18(26)20(19(27)10-12)14-5-8-16-17(11-14)23(29)24(30)21(22(16)28)13-3-6-15(25)7-4-13/h3-4,6-7,9-10,14H,2,5,8,11H2,1H3 |
| InChIKey | BWTQBJIOCKZBSQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|