C25H18F8O — CID 139853026
2-(4-ethyl-2,3-difluorophenyl)-5,7,8-trifluoro-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853026) has the molecular formula C25H18F8O and a molecular weight of 486.40 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-difluorophenyl)-5,7,8-trifluoro-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(4-ethyl-2,3-difluorophenyl)-5,7,8-trifluoro-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853026 |
| Molecular Formula | C25H18F8O |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-(4-ethyl-2,3-difluorophenyl)-5,7,8-trifluoro-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCc1ccc(C2CCc3c(F)c(-c4ccc(OC(F)(F)F)cc4)c(F)c(F)c3C2)c(F)c1F |
| InChI | InChI=1S/C25H18F8O/c1-2-12-5-9-16(22(28)20(12)26)14-6-10-17-18(11-14)23(29)24(30)19(21(17)27)13-3-7-15(8-4-13)34-25(31,32)33/h3-5,7-9,14H,2,6,10-11H2,1H3 |
| InChIKey | IVXKLMVSTMMELQ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|