C14H6BrF7O — CID 118845186
1-(bromomethyl)-2,3,5,6-tetrafluoro-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 118845186) has the molecular formula C14H6BrF7O and a molecular weight of 403.09 g/mol. Its IUPAC name is 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 118845186 |
| Molecular Formula | C14H6BrF7O |
| Molecular Weight | 403.09 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | Fc1c(F)c(-c2ccc(OC(F)(F)F)cc2)c(F)c(F)c1CBr |
| InChI | InChI=1S/C14H6BrF7O/c15-5-8-10(16)12(18)9(13(19)11(8)17)6-1-3-7(4-2-6)23-14(20,21)22/h1-4H,5H2 |
| InChIKey | VFNHSEJYBDKWFS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.09 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|