C13H4ClF7O — CID 134627917
1-chloro-2,3,5,6-tetrafluoro-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 134627917) has the molecular formula C13H4ClF7O and a molecular weight of 344.61 g/mol. Its IUPAC name is 1-chloro-2,3,5,6-tetrafluoro-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1-chloro-2,3,5,6-tetrafluoro-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 134627917 |
| Molecular Formula | C13H4ClF7O |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 1-chloro-2,3,5,6-tetrafluoro-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | Fc1c(F)c(-c2ccc(OC(F)(F)F)cc2)c(F)c(F)c1Cl |
| InChI | InChI=1S/C13H4ClF7O/c14-8-11(17)9(15)7(10(16)12(8)18)5-1-3-6(4-2-5)22-13(19,20)21/h1-4H |
| InChIKey | OCWNFRHZWHBJMC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|