C26H20F8 — CID 139853416
2-(4-butyl-2,6-difluorophenyl)-5,7,8-trifluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853416) has the molecular formula C26H20F8 and a molecular weight of 484.43 g/mol. Its IUPAC name is 2-(4-butyl-2,6-difluorophenyl)-5,7,8-trifluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(4-butyl-2,6-difluorophenyl)-5,7,8-trifluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853416 |
| Molecular Formula | C26H20F8 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-(4-butyl-2,6-difluorophenyl)-5,7,8-trifluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCc1cc(F)c(C2CCc3c(F)c(-c4cc(F)c(F)c(F)c4)c(F)c(F)c3C2)c(F)c1 |
| InChI | InChI=1S/C26H20F8/c1-2-3-4-12-7-17(27)21(18(28)8-12)13-5-6-15-16(9-13)24(32)26(34)22(23(15)31)14-10-19(29)25(33)20(30)11-14/h7-8,10-11,13H,2-6,9H2,1H3 |
| InChIKey | UMWFBNKHFXSIBB-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|