C9H8BrF3 — CID 146676084
1-(bromomethyl)-2,4,6-trifluoro-3,5-dimethylbenzene (PubChem CID 146676084) has the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. Its IUPAC name is 1-(bromomethyl)-2,4,6-trifluoro-3,5-dimethylbenzene.
| Compound Name | 1-(bromomethyl)-2,4,6-trifluoro-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 146676084 |
| Molecular Formula | C9H8BrF3 |
| Molecular Weight | 253.06 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 1-(bromomethyl)-2,4,6-trifluoro-3,5-dimethylbenzene |
| SMILES | Cc1c(F)c(C)c(F)c(CBr)c1F |
| InChI | InChI=1S/C9H8BrF3/c1-4-7(11)5(2)9(13)6(3-10)8(4)12/h3H2,1-2H3 |
| InChIKey | GTDMFWMMIAQLII-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.06 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|