C8H2Br4F4 — CID 170603228
1-(bromomethyl)-2,3,5,6-tetrafluoro-4-(tribromomethyl)benzene (PubChem CID 170603228) has the molecular formula C8H2Br4F4 and a molecular weight of 493.71 g/mol. Its IUPAC name is 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-(tribromomethyl)benzene.
| Compound Name | 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-(tribromomethyl)benzene |
|---|---|
| PubChem CID | 170603228 |
| Molecular Formula | C8H2Br4F4 |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 489.68 |
| IUPAC Name | 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-(tribromomethyl)benzene |
| SMILES | Fc1c(F)c(C(Br)(Br)Br)c(F)c(F)c1CBr |
| InChI | InChI=1S/C8H2Br4F4/c9-1-2-4(13)6(15)3(8(10,11)12)7(16)5(2)14/h1H2 |
| InChIKey | XINIETGVZIZUGJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|