C13H13BrF4O2 — CID 14423027
2-[[4-(bromomethyl)-2,3,5,6-tetrafluorophenyl]methoxy]oxane (PubChem CID 14423027) has the molecular formula C13H13BrF4O2 and a molecular weight of 357.14 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)-2,3,5,6-tetrafluorophenyl]methoxy]oxane.
| Compound Name | 2-[[4-(bromomethyl)-2,3,5,6-tetrafluorophenyl]methoxy]oxane |
|---|---|
| PubChem CID | 14423027 |
| Molecular Formula | C13H13BrF4O2 |
| Molecular Weight | 357.14 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 2-[[4-(bromomethyl)-2,3,5,6-tetrafluorophenyl]methoxy]oxane |
| SMILES | Fc1c(F)c(COC2CCCCO2)c(F)c(F)c1CBr |
| InChI | InChI=1S/C13H13BrF4O2/c14-5-7-10(15)12(17)8(13(18)11(7)16)6-20-9-3-1-2-4-19-9/h9H,1-6H2 |
| InChIKey | GLXNHVVCZYRHPM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.14 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|