C14H16F4O2S — CID 13075315
2-[(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)methoxy]oxane (PubChem CID 13075315) has the molecular formula C14H16F4O2S and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)methoxy]oxane.
| Compound Name | 2-[(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)methoxy]oxane |
|---|---|
| PubChem CID | 13075315 |
| Molecular Formula | C14H16F4O2S |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)methoxy]oxane |
| SMILES | CCSc1c(F)c(F)c(COC2CCCCO2)c(F)c1F |
| InChI | InChI=1S/C14H16F4O2S/c1-2-21-14-12(17)10(15)8(11(16)13(14)18)7-20-9-5-3-4-6-19-9/h9H,2-7H2,1H3 |
| InChIKey | FCEJHXZLFNQOGX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|