C8H7F5O2 — CID 140699020
2,6-difluoro-1-(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-ol (PubChem CID 140699020) has the molecular formula C8H7F5O2 and a molecular weight of 230.13 g/mol. Its IUPAC name is 2,6-difluoro-1-(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-ol.
| Compound Name | 2,6-difluoro-1-(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 140699020 |
| Molecular Formula | C8H7F5O2 |
| Molecular Weight | 230.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2,6-difluoro-1-(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1(OCC(F)(F)F)C(F)=CC=CC1F |
| InChI | InChI=1S/C8H7F5O2/c9-5-2-1-3-6(10)8(5,14)15-4-7(11,12)13/h1-3,5,14H,4H2 |
| InChIKey | NPVLACXLBFEAOC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.13 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|