C11H7F13O3 — CID 155670544
3,3,4,4-tetrafluoro-1,5,5-tris(2,2,2-trifluoroethoxy)cyclopentene (PubChem CID 155670544) has the molecular formula C11H7F13O3 and a molecular weight of 434.15 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1,5,5-tris(2,2,2-trifluoroethoxy)cyclopentene.
| Compound Name | 3,3,4,4-tetrafluoro-1,5,5-tris(2,2,2-trifluoroethoxy)cyclopentene |
|---|---|
| PubChem CID | 155670544 |
| Molecular Formula | C11H7F13O3 |
| Molecular Weight | 434.15 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1,5,5-tris(2,2,2-trifluoroethoxy)cyclopentene |
| SMILES | FC(F)(F)COC1=CC(F)(F)C(F)(F)C1(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C11H7F13O3/c12-6(13)1-5(25-2-7(14,15)16)10(11(6,23)24,26-3-8(17,18)19)27-4-9(20,21)22/h1H,2-4H2 |
| InChIKey | FTMVTRNRHBNNCH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.15 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|