C10H8ClF3N2O — CID 141036711
2-(2,2,2-trifluoroethoxy)quinazoline;hydrochloride (PubChem CID 141036711) has the molecular formula C10H8ClF3N2O and a molecular weight of 264.63 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)quinazoline;hydrochloride.
| Compound Name | 2-(2,2,2-trifluoroethoxy)quinazoline;hydrochloride |
|---|---|
| PubChem CID | 141036711 |
| Molecular Formula | C10H8ClF3N2O |
| Molecular Weight | 264.63 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)quinazoline;hydrochloride |
| SMILES | Cl.FC(F)(F)COc1ncc2ccccc2n1 |
| InChI | InChI=1S/C10H7F3N2O.ClH/c11-10(12,13)6-16-9-14-5-7-3-1-2-4-8(7)15-9;/h1-5H,6H2;1H |
| InChIKey | OLQKJJPOMDGDHR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |