C12H10F6O8 — CID 163685803
5,10-dihydroxy-2,7-bis(2,2,2-trifluoroethoxy)-4,9-dioxatricyclo[5.3.0.02,6]decane-3,8-dione (PubChem CID 163685803) has the molecular formula C12H10F6O8 and a molecular weight of 396.19 g/mol. Its IUPAC name is 5,10-dihydroxy-2,7-bis(2,2,2-trifluoroethoxy)-4,9-dioxatricyclo[5.3.0.02,6]decane-3,8-dione.
| Compound Name | 5,10-dihydroxy-2,7-bis(2,2,2-trifluoroethoxy)-4,9-dioxatricyclo[5.3.0.02,6]decane-3,8-dione |
|---|---|
| PubChem CID | 163685803 |
| Molecular Formula | C12H10F6O8 |
| Molecular Weight | 396.19 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 5,10-dihydroxy-2,7-bis(2,2,2-trifluoroethoxy)-4,9-dioxatricyclo[5.3.0.02,6]decane-3,8-dione |
| SMILES | O=C1OC(O)C2C1(OCC(F)(F)F)C1C(O)OC(=O)C21OCC(F)(F)F |
| InChI | InChI=1S/C12H10F6O8/c13-9(14,15)1-23-11-3(5(19)25-7(11)21)12(24-2-10(16,17)18)4(11)6(20)26-8(12)22/h3-6,19-20H,1-2H2 |
| InChIKey | JOTQCVUVHWGFQU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |