C7H8F5NO3 — CID 106492828
3,3-difluoro-5-[(2,2,2-trifluoroethoxyamino)methyl]oxolan-2-one (PubChem CID 106492828) has the molecular formula C7H8F5NO3 and a molecular weight of 249.13 g/mol. Its IUPAC name is 3,3-difluoro-5-[(2,2,2-trifluoroethoxyamino)methyl]oxolan-2-one.
| Compound Name | 3,3-difluoro-5-[(2,2,2-trifluoroethoxyamino)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 106492828 |
| Molecular Formula | C7H8F5NO3 |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3,3-difluoro-5-[(2,2,2-trifluoroethoxyamino)methyl]oxolan-2-one |
| SMILES | O=C1OC(CNOCC(F)(F)F)CC1(F)F |
| InChI | InChI=1S/C7H8F5NO3/c8-6(9)1-4(16-5(6)14)2-13-15-3-7(10,11)12/h4,13H,1-3H2 |
| InChIKey | GBKZTSHNWNLJJI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|