C10H17F2N3O3 — CID 106492848
3-[2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 106492848) has the molecular formula C10H17F2N3O3 and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-[2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 106492848 |
| Molecular Formula | C10H17F2N3O3 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-[2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C10H17F2N3O3/c1-15(2)9(17)14-4-3-13-6-7-5-10(11,12)8(16)18-7/h7,13H,3-6H2,1-2H3,(H,14,17) |
| InChIKey | WOCUCZYYIPDIHA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|