About 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one
5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492839) has the molecular formula C7H12F2N2O2
and a molecular weight of 194.18 g/mol. Its IUPAC name is 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one.
Molecular Properties
| Compound Name | 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one |
| PubChem CID | 106492839 |
| Molecular Formula | C7H12F2N2O2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one |
| SMILES | CN(C)NCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C7H12F2N2O2/c1-11(2)10-4-5-3-7(8,9)6(12)13-5/h5,10H,3-4H2,1-2H3 |
| InChIKey | YTEYACMONJQGRU-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one?
The IUPAC name of 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one (CID 106492839) is 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one.
What is the SMILES notation for 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one?
The canonical SMILES for 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one is CN(C)NCC1CC(F)(F)C(=O)O1.
What is the InChIKey of 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one?
The InChIKey is YTEYACMONJQGRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N2O2/c1-11(2)10-4-5-3-7(8,9)6(12)13-5/h5,10H,3-4H2,1-2H3.
What are the key properties of 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one?
5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one has a molecular weight of 194.18 g/mol, XLogP of 0.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2-dimethylhydrazinyl)methyl]-3,3-difluorooxolan-2-one is sourced from PubChem (CID 106492839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).