C12H19F2NO2 — CID 106492650
5-[(1-cyclopentylethylamino)methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492650) has the molecular formula C12H19F2NO2 and a molecular weight of 247.28 g/mol. Its IUPAC name is 5-[(1-cyclopentylethylamino)methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[(1-cyclopentylethylamino)methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492650 |
| Molecular Formula | C12H19F2NO2 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 5-[(1-cyclopentylethylamino)methyl]-3,3-difluorooxolan-2-one |
| SMILES | CC(NCC1CC(F)(F)C(=O)O1)C1CCCC1 |
| InChI | InChI=1S/C12H19F2NO2/c1-8(9-4-2-3-5-9)15-7-10-6-12(13,14)11(16)17-10/h8-10,15H,2-7H2,1H3 |
| InChIKey | BWKMWBNNLTXVDX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |