C11H19F2NO2S — CID 106492953
5-[(4-ethylsulfanylbutan-2-ylamino)methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492953) has the molecular formula C11H19F2NO2S and a molecular weight of 267.34 g/mol. Its IUPAC name is 5-[(4-ethylsulfanylbutan-2-ylamino)methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[(4-ethylsulfanylbutan-2-ylamino)methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492953 |
| Molecular Formula | C11H19F2NO2S |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 5-[(4-ethylsulfanylbutan-2-ylamino)methyl]-3,3-difluorooxolan-2-one |
| SMILES | CCSCCC(C)NCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C11H19F2NO2S/c1-3-17-5-4-8(2)14-7-9-6-11(12,13)10(15)16-9/h8-9,14H,3-7H2,1-2H3 |
| InChIKey | PMGFQXDCWTUNOX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|