C9H13F2NO2 — CID 106492972
3,3-difluoro-5-[(2-methylprop-2-enylamino)methyl]oxolan-2-one (PubChem CID 106492972) has the molecular formula C9H13F2NO2 and a molecular weight of 205.20 g/mol. Its IUPAC name is 3,3-difluoro-5-[(2-methylprop-2-enylamino)methyl]oxolan-2-one.
| Compound Name | 3,3-difluoro-5-[(2-methylprop-2-enylamino)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 106492972 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3,3-difluoro-5-[(2-methylprop-2-enylamino)methyl]oxolan-2-one |
| SMILES | C=C(C)CNCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C9H13F2NO2/c1-6(2)4-12-5-7-3-9(10,11)8(13)14-7/h7,12H,1,3-5H2,2H3 |
| InChIKey | ITHBIGWJSMTNCC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|