C7H12F2N2O2 — CID 106492558
5-[(2-aminoethylamino)methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492558) has the molecular formula C7H12F2N2O2 and a molecular weight of 194.18 g/mol. Its IUPAC name is 5-[(2-aminoethylamino)methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[(2-aminoethylamino)methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492558 |
| Molecular Formula | C7H12F2N2O2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-[(2-aminoethylamino)methyl]-3,3-difluorooxolan-2-one |
| SMILES | NCCNCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C7H12F2N2O2/c8-7(9)3-5(13-6(7)12)4-11-2-1-10/h5,11H,1-4,10H2 |
| InChIKey | WBVIAKZPSGQDHF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|