C13H13F4NO2 — CID 106492587
5-[[2-(3,5-difluorophenyl)ethylamino]methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492587) has the molecular formula C13H13F4NO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is 5-[[2-(3,5-difluorophenyl)ethylamino]methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[[2-(3,5-difluorophenyl)ethylamino]methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492587 |
| Molecular Formula | C13H13F4NO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-[[2-(3,5-difluorophenyl)ethylamino]methyl]-3,3-difluorooxolan-2-one |
| SMILES | O=C1OC(CNCCc2cc(F)cc(F)c2)CC1(F)F |
| InChI | InChI=1S/C13H13F4NO2/c14-9-3-8(4-10(15)5-9)1-2-18-7-11-6-13(16,17)12(19)20-11/h3-5,11,18H,1-2,6-7H2 |
| InChIKey | AXYJBAJSTQOCCW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|