C15H20F2N2O2 — CID 106492260
3,3-difluoro-5-[[3-(N-methylanilino)propylamino]methyl]oxolan-2-one (PubChem CID 106492260) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 3,3-difluoro-5-[[3-(N-methylanilino)propylamino]methyl]oxolan-2-one.
| Compound Name | 3,3-difluoro-5-[[3-(N-methylanilino)propylamino]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 106492260 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3,3-difluoro-5-[[3-(N-methylanilino)propylamino]methyl]oxolan-2-one |
| SMILES | CN(CCCNCC1CC(F)(F)C(=O)O1)c1ccccc1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-19(12-6-3-2-4-7-12)9-5-8-18-11-13-10-15(16,17)14(20)21-13/h2-4,6-7,13,18H,5,8-11H2,1H3 |
| InChIKey | UIVMJVNKJATFIX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|