C10H16F2N2O3 — CID 106237134
5-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]pentanamide (PubChem CID 106237134) has the molecular formula C10H16F2N2O3 and a molecular weight of 250.24 g/mol. Its IUPAC name is 5-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]pentanamide.
| Compound Name | 5-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]pentanamide |
|---|---|
| PubChem CID | 106237134 |
| Molecular Formula | C10H16F2N2O3 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]pentanamide |
| SMILES | NC(=O)CCCCNCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C10H16F2N2O3/c11-10(12)5-7(17-9(10)16)6-14-4-2-1-3-8(13)15/h7,14H,1-6H2,(H2,13,15) |
| InChIKey | VVBMLOZDPNFOOJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|