C11H12ClF2NO2S — CID 106046328
5-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-3,3-difluorooxolan-2-one (PubChem CID 106046328) has the molecular formula C11H12ClF2NO2S and a molecular weight of 295.74 g/mol. Its IUPAC name is 5-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106046328 |
| Molecular Formula | C11H12ClF2NO2S |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-3,3-difluorooxolan-2-one |
| SMILES | O=C1OC(CNCCc2ccc(Cl)s2)CC1(F)F |
| InChI | InChI=1S/C11H12ClF2NO2S/c12-9-2-1-8(18-9)3-4-15-6-7-5-11(13,14)10(16)17-7/h1-2,7,15H,3-6H2 |
| InChIKey | BWEWXVIJUAMADO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|