C10H17F2NO4 — CID 106492532
3,3-difluoro-5-[[2-(2-methoxyethoxy)ethylamino]methyl]oxolan-2-one (PubChem CID 106492532) has the molecular formula C10H17F2NO4 and a molecular weight of 253.24 g/mol. Its IUPAC name is 3,3-difluoro-5-[[2-(2-methoxyethoxy)ethylamino]methyl]oxolan-2-one.
| Compound Name | 3,3-difluoro-5-[[2-(2-methoxyethoxy)ethylamino]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 106492532 |
| Molecular Formula | C10H17F2NO4 |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3,3-difluoro-5-[[2-(2-methoxyethoxy)ethylamino]methyl]oxolan-2-one |
| SMILES | COCCOCCNCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C10H17F2NO4/c1-15-4-5-16-3-2-13-7-8-6-10(11,12)9(14)17-8/h8,13H,2-7H2,1H3 |
| InChIKey | VHZOFGPFRWOJNZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|