C13H16F2N2O2 — CID 106492816
5-[[3-(dimethylamino)anilino]methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492816) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 5-[[3-(dimethylamino)anilino]methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[[3-(dimethylamino)anilino]methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492816 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 5-[[3-(dimethylamino)anilino]methyl]-3,3-difluorooxolan-2-one |
| SMILES | CN(C)c1cccc(NCC2CC(F)(F)C(=O)O2)c1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-17(2)10-5-3-4-9(6-10)16-8-11-7-13(14,15)12(18)19-11/h3-6,11,16H,7-8H2,1-2H3 |
| InChIKey | BJRPHIKEHLKCIB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |