C13H15F2NO4 — CID 106492270
5-[(3,4-dimethoxyanilino)methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492270) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyanilino)methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[(3,4-dimethoxyanilino)methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492270 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-[(3,4-dimethoxyanilino)methyl]-3,3-difluorooxolan-2-one |
| SMILES | COc1ccc(NCC2CC(F)(F)C(=O)O2)cc1OC |
| InChI | InChI=1S/C13H15F2NO4/c1-18-10-4-3-8(5-11(10)19-2)16-7-9-6-13(14,15)12(17)20-9/h3-5,9,16H,6-7H2,1-2H3 |
| InChIKey | FQWPWGRHOPGABC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|