C15H12BrF2NO2 — CID 106492765
5-[[(6-bromonaphthalen-2-yl)amino]methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492765) has the molecular formula C15H12BrF2NO2 and a molecular weight of 356.17 g/mol. Its IUPAC name is 5-[[(6-bromonaphthalen-2-yl)amino]methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[[(6-bromonaphthalen-2-yl)amino]methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492765 |
| Molecular Formula | C15H12BrF2NO2 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 5-[[(6-bromonaphthalen-2-yl)amino]methyl]-3,3-difluorooxolan-2-one |
| SMILES | O=C1OC(CNc2ccc3cc(Br)ccc3c2)CC1(F)F |
| InChI | InChI=1S/C15H12BrF2NO2/c16-11-3-1-10-6-12(4-2-9(10)5-11)19-8-13-7-15(17,18)14(20)21-13/h1-6,13,19H,7-8H2 |
| InChIKey | LGPHZWQTPZBVPQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |